ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
| 상품명칭 |
3-Methylbenzo[b]thiophene |
| 영문 이름 |
3-Methylbenzo[b]thiophene; Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
| 분자식 |
C9H8S |
| 분자량 |
148.2248 |
| InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| cas번호 |
1455-18-1 |
| EC번호 |
215-934-6 |
| 분자 구조 |
![1455-18-1 3-Methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/485/136485.gif)
|
| 밀도 |
1.146g/cm3 |
| 비등점 |
243°C at 760 mmHg |
| 굴절 지수 |
1.652 |
| 인화점 |
72.4°C |
| 증기압 |
0.0514mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
